About 1-(methoxymethyl)-3,5-dimethyl-1,3,5-triazinan-2-one
1-(methoxymethyl)-3,5-dimethyl-1,3,5-triazinan-2-one (PubChem CID 18721204) has the molecular formula C7H15N3O2
and a molecular weight of 173.22 g/mol. Its IUPAC name is 1-(methoxymethyl)-3,5-dimethyl-1,3,5-triazinan-2-one.
Molecular Properties
| Compound Name | 1-(methoxymethyl)-3,5-dimethyl-1,3,5-triazinan-2-one |
| PubChem CID | 18721204 |
| Molecular Formula | C7H15N3O2 |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 1-(methoxymethyl)-3,5-dimethyl-1,3,5-triazinan-2-one |
| SMILES | COCN1CN(C)CN(C)C1=O |
| InChI | InChI=1S/C7H15N3O2/c1-8-4-9(2)7(11)10(5-8)6-12-3/h4-6H2,1-3H3 |
| InChIKey | XAKAFYZJRXXIKZ-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(methoxymethyl)-3,5-dimethyl-1,3,5-triazinan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(methoxymethyl)-3,5-dimethyl-1,3,5-triazinan-2-one?
The IUPAC name of 1-(methoxymethyl)-3,5-dimethyl-1,3,5-triazinan-2-one (CID 18721204) is 1-(methoxymethyl)-3,5-dimethyl-1,3,5-triazinan-2-one.
What is the SMILES notation for 1-(methoxymethyl)-3,5-dimethyl-1,3,5-triazinan-2-one?
The canonical SMILES for 1-(methoxymethyl)-3,5-dimethyl-1,3,5-triazinan-2-one is COCN1CN(C)CN(C)C1=O.
What is the InChIKey of 1-(methoxymethyl)-3,5-dimethyl-1,3,5-triazinan-2-one?
The InChIKey is XAKAFYZJRXXIKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N3O2/c1-8-4-9(2)7(11)10(5-8)6-12-3/h4-6H2,1-3H3.
What are the key properties of 1-(methoxymethyl)-3,5-dimethyl-1,3,5-triazinan-2-one?
1-(methoxymethyl)-3,5-dimethyl-1,3,5-triazinan-2-one has a molecular weight of 173.22 g/mol, XLogP of -0.20, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(methoxymethyl)-3,5-dimethyl-1,3,5-triazinan-2-one is sourced from PubChem (CID 18721204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).