About 2-methyl-4-octyl-1H-1,2,4-triazol-4-ium-5-thione
2-methyl-4-octyl-1H-1,2,4-triazol-4-ium-5-thione (PubChem CID 18721223) has the molecular formula C11H22N3S+
and a molecular weight of 228.38 g/mol. Its IUPAC name is 2-methyl-4-octyl-1H-1,2,4-triazol-4-ium-5-thione.
Molecular Properties
| Compound Name | 2-methyl-4-octyl-1H-1,2,4-triazol-4-ium-5-thione |
| PubChem CID | 18721223 |
| Molecular Formula | C11H22N3S+ |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | 2-methyl-4-octyl-1H-1,2,4-triazol-4-ium-5-thione |
| SMILES | CCCCCCCC[n+]1cn(C)[nH]c1=S |
| InChI | InChI=1S/C11H21N3S/c1-3-4-5-6-7-8-9-14-10-13(2)12-11(14)15/h10H,3-9H2,1-2H3/p+1 |
| InChIKey | DMJQZRMKNVQCQR-UHFFFAOYSA-O |
| XLogP | 2.73 |
| TPSA | 24.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-4-octyl-1H-1,2,4-triazol-4-ium-5-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4-octyl-1H-1,2,4-triazol-4-ium-5-thione?
The IUPAC name of 2-methyl-4-octyl-1H-1,2,4-triazol-4-ium-5-thione (CID 18721223) is 2-methyl-4-octyl-1H-1,2,4-triazol-4-ium-5-thione.
What is the SMILES notation for 2-methyl-4-octyl-1H-1,2,4-triazol-4-ium-5-thione?
The canonical SMILES for 2-methyl-4-octyl-1H-1,2,4-triazol-4-ium-5-thione is CCCCCCCC[n+]1cn(C)[nH]c1=S.
What is the InChIKey of 2-methyl-4-octyl-1H-1,2,4-triazol-4-ium-5-thione?
The InChIKey is DMJQZRMKNVQCQR-UHFFFAOYSA-O. The full InChI is InChI=1S/C11H21N3S/c1-3-4-5-6-7-8-9-14-10-13(2)12-11(14)15/h10H,3-9H2,1-2H3/p+1.
What are the key properties of 2-methyl-4-octyl-1H-1,2,4-triazol-4-ium-5-thione?
2-methyl-4-octyl-1H-1,2,4-triazol-4-ium-5-thione has a molecular weight of 228.38 g/mol, XLogP of 2.73, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-octyl-1H-1,2,4-triazol-4-ium-5-thione is sourced from PubChem (CID 18721223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).