About 4,5-dimethyl-3H-1,3,4-oxadiazol-4-ium-2-thione
4,5-dimethyl-3H-1,3,4-oxadiazol-4-ium-2-thione (PubChem CID 18721246) has the molecular formula C4H7N2OS+
and a molecular weight of 131.18 g/mol. Its IUPAC name is 4,5-dimethyl-3H-1,3,4-oxadiazol-4-ium-2-thione.
Molecular Properties
| Compound Name | 4,5-dimethyl-3H-1,3,4-oxadiazol-4-ium-2-thione |
| PubChem CID | 18721246 |
| Molecular Formula | C4H7N2OS+ |
| Molecular Weight | 131.18 g/mol |
| Exact Mass | 131.03 |
| IUPAC Name | 4,5-dimethyl-3H-1,3,4-oxadiazol-4-ium-2-thione |
| SMILES | Cc1oc(=S)[nH][n+]1C |
| InChI | InChI=1S/C4H6N2OS/c1-3-6(2)5-4(8)7-3/h1-2H3/p+1 |
| InChIKey | OPPYOTNAGFAPJV-UHFFFAOYSA-O |
| XLogP | 0.47 |
| TPSA | 32.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.18 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4,5-dimethyl-3H-1,3,4-oxadiazol-4-ium-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethyl-3H-1,3,4-oxadiazol-4-ium-2-thione?
The IUPAC name of 4,5-dimethyl-3H-1,3,4-oxadiazol-4-ium-2-thione (CID 18721246) is 4,5-dimethyl-3H-1,3,4-oxadiazol-4-ium-2-thione.
What is the SMILES notation for 4,5-dimethyl-3H-1,3,4-oxadiazol-4-ium-2-thione?
The canonical SMILES for 4,5-dimethyl-3H-1,3,4-oxadiazol-4-ium-2-thione is Cc1oc(=S)[nH][n+]1C.
What is the InChIKey of 4,5-dimethyl-3H-1,3,4-oxadiazol-4-ium-2-thione?
The InChIKey is OPPYOTNAGFAPJV-UHFFFAOYSA-O. The full InChI is InChI=1S/C4H6N2OS/c1-3-6(2)5-4(8)7-3/h1-2H3/p+1.
What are the key properties of 4,5-dimethyl-3H-1,3,4-oxadiazol-4-ium-2-thione?
4,5-dimethyl-3H-1,3,4-oxadiazol-4-ium-2-thione has a molecular weight of 131.18 g/mol, XLogP of 0.47, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethyl-3H-1,3,4-oxadiazol-4-ium-2-thione is sourced from PubChem (CID 18721246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).