C10H7NNaO4S+ — CID 18721311
sodium 7-oxidoperoxysulfanyl-3-oxa-1-azoniatricyclo[6.3.1.04,12]dodeca-1(11),4(12),5,7,9-pentaene (PubChem CID 18721311) has the molecular formula C10H7NNaO4S+ and a molecular weight of 260.23 g/mol. Its IUPAC name is sodium 7-oxidoperoxysulfanyl-3-oxa-1-azoniatricyclo[6.3.1.04,12]dodeca-1(11),4(12),5,7,9-pentaene.
| Compound Name | sodium 7-oxidoperoxysulfanyl-3-oxa-1-azoniatricyclo[6.3.1.04,12]dodeca-1(11),4(12),5,7,9-pentaene |
|---|---|
| PubChem CID | 18721311 |
| Molecular Formula | C10H7NNaO4S+ |
| Molecular Weight | 260.23 g/mol |
| Exact Mass | 260.00 |
| IUPAC Name | sodium 7-oxidoperoxysulfanyl-3-oxa-1-azoniatricyclo[6.3.1.04,12]dodeca-1(11),4(12),5,7,9-pentaene |
| SMILES | [Na+].[O-]OOSc1ccc2c3c1ccc[n+]3CO2 |
| InChI | InChI=1S/C10H7NO4S.Na/c12-14-15-16-9-4-3-8-10-7(9)2-1-5-11(10)6-13-8;/h1-5H,6H2;/q;+1 |
| InChIKey | PANRMGCHCJVICI-UHFFFAOYSA-N |
| XLogP | -2.29 |
| TPSA | 54.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.23 |
| LogP ≤ 5 | -2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|