C24H27F3O4 — CID 18721498
6-[hydroxy-[2-methyl-3-(3-methylbut-2-en-2-yl)-4-(trifluoromethyl)phenyl]methylidene]-2,2,4,4-tetramethylcyclohexane-1,3,5-trione (PubChem CID 18721498) has the molecular formula C24H27F3O4 and a molecular weight of 436.47 g/mol. Its IUPAC name is 6-[hydroxy-[2-methyl-3-(3-methylbut-2-en-2-yl)-4-(trifluoromethyl)phenyl]methylidene]-2,2,4,4-tetramethylcyclohexane-1,3,5-trione.
| Compound Name | 6-[hydroxy-[2-methyl-3-(3-methylbut-2-en-2-yl)-4-(trifluoromethyl)phenyl]methylidene]-2,2,4,4-tetramethylcyclohexane-1,3,5-trione |
|---|---|
| PubChem CID | 18721498 |
| Molecular Formula | C24H27F3O4 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | 6-[hydroxy-[2-methyl-3-(3-methylbut-2-en-2-yl)-4-(trifluoromethyl)phenyl]methylidene]-2,2,4,4-tetramethylcyclohexane-1,3,5-trione |
| SMILES | CC(C)=C(C)c1c(C(F)(F)F)ccc(C(O)=C2C(=O)C(C)(C)C(=O)C(C)(C)C2=O)c1C |
| InChI | InChI=1S/C24H27F3O4/c1-11(2)12(3)16-13(4)14(9-10-15(16)24(25,26)27)18(28)17-19(29)22(5,6)21(31)23(7,8)20(17)30/h9-10,28H,1-8H3 |
| InChIKey | ASYGDWYPHUTFGB-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|