C23H25F3O4 — CID 18721499
(4E)-4-[hydroxy-[2-methyl-3-(3-methylbut-2-en-2-yl)-4-(trifluoromethyl)phenyl]methylidene]-2,2,6-trimethylcyclohexane-1,3,5-trione (PubChem CID 18721499) has the molecular formula C23H25F3O4 and a molecular weight of 422.44 g/mol. Its IUPAC name is (4E)-4-[hydroxy-[2-methyl-3-(3-methylbut-2-en-2-yl)-4-(trifluoromethyl)phenyl]methylidene]-2,2,6-trimethylcyclohexane-1,3,5-trione.
| Compound Name | (4E)-4-[hydroxy-[2-methyl-3-(3-methylbut-2-en-2-yl)-4-(trifluoromethyl)phenyl]methylidene]-2,2,6-trimethylcyclohexane-1,3,5-trione |
|---|---|
| PubChem CID | 18721499 |
| Molecular Formula | C23H25F3O4 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | (4E)-4-[hydroxy-[2-methyl-3-(3-methylbut-2-en-2-yl)-4-(trifluoromethyl)phenyl]methylidene]-2,2,6-trimethylcyclohexane-1,3,5-trione |
| SMILES | CC(C)=C(C)c1c(C(F)(F)F)ccc(/C(O)=C2/C(=O)C(C)C(=O)C(C)(C)C2=O)c1C |
| InChI | InChI=1S/C23H25F3O4/c1-10(2)11(3)16-12(4)14(8-9-15(16)23(24,25)26)19(28)17-18(27)13(5)20(29)22(6,7)21(17)30/h8-9,13,28H,1-7H3/b19-17+ |
| InChIKey | ZGQFWGKYACACMN-HTXNQAPBSA-N |
| XLogP | 5.48 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|