C22H25F3O3 — CID 18721500
2-[hydroxy-[2-methyl-3-(3-methylbut-2-en-2-yl)-4-(trifluoromethyl)phenyl]methylidene]-5,5-dimethylcyclohexane-1,3-dione (PubChem CID 18721500) has the molecular formula C22H25F3O3 and a molecular weight of 394.43 g/mol. Its IUPAC name is 2-[hydroxy-[2-methyl-3-(3-methylbut-2-en-2-yl)-4-(trifluoromethyl)phenyl]methylidene]-5,5-dimethylcyclohexane-1,3-dione.
| Compound Name | 2-[hydroxy-[2-methyl-3-(3-methylbut-2-en-2-yl)-4-(trifluoromethyl)phenyl]methylidene]-5,5-dimethylcyclohexane-1,3-dione |
|---|---|
| PubChem CID | 18721500 |
| Molecular Formula | C22H25F3O3 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | 2-[hydroxy-[2-methyl-3-(3-methylbut-2-en-2-yl)-4-(trifluoromethyl)phenyl]methylidene]-5,5-dimethylcyclohexane-1,3-dione |
| SMILES | CC(C)=C(C)c1c(C(F)(F)F)ccc(C(O)=C2C(=O)CC(C)(C)CC2=O)c1C |
| InChI | InChI=1S/C22H25F3O3/c1-11(2)12(3)18-13(4)14(7-8-15(18)22(23,24)25)20(28)19-16(26)9-21(5,6)10-17(19)27/h7-8,28H,9-10H2,1-6H3 |
| InChIKey | QJNIBUSGHHVVBY-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|