C9H11Cl2N — CID 18721638
1-(2,4-dichloro-6-methylphenyl)-N-methylmethanamine (PubChem CID 18721638) has the molecular formula C9H11Cl2N and a molecular weight of 204.10 g/mol. Its IUPAC name is 1-(2,4-dichloro-6-methylphenyl)-N-methylmethanamine.
| Compound Name | 1-(2,4-dichloro-6-methylphenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 18721638 |
| Molecular Formula | C9H11Cl2N |
| Molecular Weight | 204.10 g/mol |
| Exact Mass | 203.03 |
| IUPAC Name | 1-(2,4-dichloro-6-methylphenyl)-N-methylmethanamine |
| SMILES | CNCc1c(C)cc(Cl)cc1Cl |
| InChI | InChI=1S/C9H11Cl2N/c1-6-3-7(10)4-9(11)8(6)5-12-2/h3-4,12H,5H2,1-2H3 |
| InChIKey | BULDYFHUONOLNV-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.10 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |