C8H15NS — CID 18721718
2,3-dimethyl-5-methylidene-1,4-thiazepane (PubChem CID 18721718) has the molecular formula C8H15NS and a molecular weight of 157.28 g/mol. Its IUPAC name is 2,3-dimethyl-5-methylidene-1,4-thiazepane.
| Compound Name | 2,3-dimethyl-5-methylidene-1,4-thiazepane |
|---|---|
| PubChem CID | 18721718 |
| Molecular Formula | C8H15NS |
| Molecular Weight | 157.28 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | 2,3-dimethyl-5-methylidene-1,4-thiazepane |
| SMILES | C=C1CCSC(C)C(C)N1 |
| InChI | InChI=1S/C8H15NS/c1-6-4-5-10-8(3)7(2)9-6/h7-9H,1,4-5H2,2-3H3 |
| InChIKey | MQHGZKLKDNWAIH-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.28 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |