C15H16N4O2 — CID 18721736
5,6,7,8,9-pentamethyl-2H-triazolo[4,5-c][1]benzazepine-4,10-dione (PubChem CID 18721736) has the molecular formula C15H16N4O2 and a molecular weight of 284.32 g/mol. Its IUPAC name is 5,6,7,8,9-pentamethyl-2H-triazolo[4,5-c][1]benzazepine-4,10-dione.
| Compound Name | 5,6,7,8,9-pentamethyl-2H-triazolo[4,5-c][1]benzazepine-4,10-dione |
|---|---|
| PubChem CID | 18721736 |
| Molecular Formula | C15H16N4O2 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 5,6,7,8,9-pentamethyl-2H-triazolo[4,5-c][1]benzazepine-4,10-dione |
| SMILES | Cc1c(C)c(C)c2c(c1C)c(=O)c1n[nH]nc1c(=O)n2C |
| InChI | InChI=1S/C15H16N4O2/c1-6-7(2)9(4)13-10(8(6)3)14(20)11-12(17-18-16-11)15(21)19(13)5/h1-5H3,(H,16,17,18) |
| InChIKey | FGXWQVZWQNDVOC-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |