C14H8ClN3O3S — CID 18721881
3-[(3E)-5-chloro-3-(2,4-dioxo-1,3-thiazolidin-5-ylidene)-2-oxoindol-1-yl]propanenitrile (PubChem CID 18721881) has the molecular formula C14H8ClN3O3S and a molecular weight of 333.76 g/mol. Its IUPAC name is 3-[(3E)-5-chloro-3-(2,4-dioxo-1,3-thiazolidin-5-ylidene)-2-oxoindol-1-yl]propanenitrile.
| Compound Name | 3-[(3E)-5-chloro-3-(2,4-dioxo-1,3-thiazolidin-5-ylidene)-2-oxoindol-1-yl]propanenitrile |
|---|---|
| PubChem CID | 18721881 |
| Molecular Formula | C14H8ClN3O3S |
| Molecular Weight | 333.76 g/mol |
| Exact Mass | 333.00 |
| IUPAC Name | 3-[(3E)-5-chloro-3-(2,4-dioxo-1,3-thiazolidin-5-ylidene)-2-oxoindol-1-yl]propanenitrile |
| SMILES | N#CCCN1C(=O)/C(=C2/SC(=O)NC2=O)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C14H8ClN3O3S/c15-7-2-3-9-8(6-7)10(11-12(19)17-14(21)22-11)13(20)18(9)5-1-4-16/h2-3,6H,1,5H2,(H,17,19,21)/b11-10+ |
| InChIKey | IOSSQSDNXNVOEX-ZHACJKMWSA-N |
| XLogP | 2.29 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.76 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|