C10H15N3O3 — CID 18722009
2,6-dimethyl-6-(methylamino)-5,7-dioxo-2,3-dihydro-1H-pyrazolo[1,2-a]pyrazole-3-carbaldehyde (PubChem CID 18722009) has the molecular formula C10H15N3O3 and a molecular weight of 225.25 g/mol. Its IUPAC name is 2,6-dimethyl-6-(methylamino)-5,7-dioxo-2,3-dihydro-1H-pyrazolo[1,2-a]pyrazole-3-carbaldehyde.
| Compound Name | 2,6-dimethyl-6-(methylamino)-5,7-dioxo-2,3-dihydro-1H-pyrazolo[1,2-a]pyrazole-3-carbaldehyde |
|---|---|
| PubChem CID | 18722009 |
| Molecular Formula | C10H15N3O3 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.11 |
| IUPAC Name | 2,6-dimethyl-6-(methylamino)-5,7-dioxo-2,3-dihydro-1H-pyrazolo[1,2-a]pyrazole-3-carbaldehyde |
| SMILES | CNC1(C)C(=O)N2CC(C)C(C=O)N2C1=O |
| InChI | InChI=1S/C10H15N3O3/c1-6-4-12-8(15)10(2,11-3)9(16)13(12)7(6)5-14/h5-7,11H,4H2,1-3H3 |
| InChIKey | MASFOLKLMJLISG-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_B(12)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|