About CID 18722884
CID 18722884 (PubChem CID 18722884) has the molecular formula C11H15B
and a molecular weight of 158.05 g/mol.
Molecular Properties
| Compound Name | CID 18722884 |
| PubChem CID | 18722884 |
| Molecular Formula | C11H15B |
| Molecular Weight | 158.05 g/mol |
| Exact Mass | 158.13 |
| IUPAC Name | — |
| SMILES | [B]c1c(C)c(C)c(C)c(C)c1C |
| InChI | InChI=1S/C11H15B/c1-6-7(2)9(4)11(12)10(5)8(6)3/h1-5H3 |
| InChIKey | NAEJLFKMPDIHRO-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.05 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 18722884 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 18722884?
The IUPAC name of CID 18722884 (CID 18722884) is not available.
What is the SMILES notation for CID 18722884?
The canonical SMILES for CID 18722884 is [B]c1c(C)c(C)c(C)c(C)c1C.
What is the InChIKey of CID 18722884?
The InChIKey is NAEJLFKMPDIHRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15B/c1-6-7(2)9(4)11(12)10(5)8(6)3/h1-5H3.
What are the key properties of CID 18722884?
CID 18722884 has a molecular weight of 158.05 g/mol, XLogP of 2.02, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 18722884 is sourced from PubChem (CID 18722884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).