C9H16N2O4S — CID 18723155
N-hydroxy-3-methylsulfonyl-8-azabicyclo[3.2.1]octane-3-carboxamide (PubChem CID 18723155) has the molecular formula C9H16N2O4S and a molecular weight of 248.30 g/mol. Its IUPAC name is N-hydroxy-3-methylsulfonyl-8-azabicyclo[3.2.1]octane-3-carboxamide.
| Compound Name | N-hydroxy-3-methylsulfonyl-8-azabicyclo[3.2.1]octane-3-carboxamide |
|---|---|
| PubChem CID | 18723155 |
| Molecular Formula | C9H16N2O4S |
| Molecular Weight | 248.30 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | N-hydroxy-3-methylsulfonyl-8-azabicyclo[3.2.1]octane-3-carboxamide |
| SMILES | CS(=O)(=O)C1(C(=O)NO)CC2CCC(C1)N2 |
| InChI | InChI=1S/C9H16N2O4S/c1-16(14,15)9(8(12)11-13)4-6-2-3-7(5-9)10-6/h6-7,10,13H,2-5H2,1H3,(H,11,12) |
| InChIKey | VMRJRDRVMUXSOH-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.30 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|