C20H25NO2 — CID 18723191
4-[4-(3,5-dimethylphenoxy)phenoxy]-1-methylpiperidine (PubChem CID 18723191) has the molecular formula C20H25NO2 and a molecular weight of 311.43 g/mol. Its IUPAC name is 4-[4-(3,5-dimethylphenoxy)phenoxy]-1-methylpiperidine.
| Compound Name | 4-[4-(3,5-dimethylphenoxy)phenoxy]-1-methylpiperidine |
|---|---|
| PubChem CID | 18723191 |
| Molecular Formula | C20H25NO2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | 4-[4-(3,5-dimethylphenoxy)phenoxy]-1-methylpiperidine |
| SMILES | Cc1cc(C)cc(Oc2ccc(OC3CCN(C)CC3)cc2)c1 |
| InChI | InChI=1S/C20H25NO2/c1-15-12-16(2)14-20(13-15)23-18-6-4-17(5-7-18)22-19-8-10-21(3)11-9-19/h4-7,12-14,19H,8-11H2,1-3H3 |
| InChIKey | VUFUVPMUHOJKFO-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |