About [(1E,3E)-hexa-1,3-dienyl]-(1H-imidazol-2-yl)-sulfanylidene-λ4-sulfane
[(1E,3E)-hexa-1,3-dienyl]-(1H-imidazol-2-yl)-sulfanylidene-λ4-sulfane (PubChem CID 18723563) has the molecular formula C9H12N2S2
and a molecular weight of 212.34 g/mol. Its IUPAC name is [(1E,3E)-hexa-1,3-dienyl]-(1H-imidazol-2-yl)-sulfanylidene-λ4-sulfane.
Molecular Properties
| Compound Name | [(1E,3E)-hexa-1,3-dienyl]-(1H-imidazol-2-yl)-sulfanylidene-λ4-sulfane |
| PubChem CID | 18723563 |
| Molecular Formula | C9H12N2S2 |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.04 |
| IUPAC Name | [(1E,3E)-hexa-1,3-dienyl]-(1H-imidazol-2-yl)-sulfanylidene-λ4-sulfane |
| SMILES | CC/C=C/C=C/S(=S)c1ncc[nH]1 |
| InChI | InChI=1S/C9H12N2S2/c1-2-3-4-5-8-13(12)9-10-6-7-11-9/h3-8H,2H2,1H3,(H,10,11)/b4-3+,8-5+ |
| InChIKey | JUMPREVZJAXPAH-SALQQRKASA-N |
| XLogP | 2.33 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(1E,3E)-hexa-1,3-dienyl]-(1H-imidazol-2-yl)-sulfanylidene-λ4-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1E,3E)-hexa-1,3-dienyl]-(1H-imidazol-2-yl)-sulfanylidene-λ4-sulfane?
The IUPAC name of [(1E,3E)-hexa-1,3-dienyl]-(1H-imidazol-2-yl)-sulfanylidene-λ4-sulfane (CID 18723563) is [(1E,3E)-hexa-1,3-dienyl]-(1H-imidazol-2-yl)-sulfanylidene-λ4-sulfane.
What is the SMILES notation for [(1E,3E)-hexa-1,3-dienyl]-(1H-imidazol-2-yl)-sulfanylidene-λ4-sulfane?
The canonical SMILES for [(1E,3E)-hexa-1,3-dienyl]-(1H-imidazol-2-yl)-sulfanylidene-λ4-sulfane is CC/C=C/C=C/S(=S)c1ncc[nH]1.
What is the InChIKey of [(1E,3E)-hexa-1,3-dienyl]-(1H-imidazol-2-yl)-sulfanylidene-λ4-sulfane?
The InChIKey is JUMPREVZJAXPAH-SALQQRKASA-N. The full InChI is InChI=1S/C9H12N2S2/c1-2-3-4-5-8-13(12)9-10-6-7-11-9/h3-8H,2H2,1H3,(H,10,11)/b4-3+,8-5+.
What are the key properties of [(1E,3E)-hexa-1,3-dienyl]-(1H-imidazol-2-yl)-sulfanylidene-λ4-sulfane?
[(1E,3E)-hexa-1,3-dienyl]-(1H-imidazol-2-yl)-sulfanylidene-λ4-sulfane has a molecular weight of 212.34 g/mol, XLogP of 2.33, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1E,3E)-hexa-1,3-dienyl]-(1H-imidazol-2-yl)-sulfanylidene-λ4-sulfane is sourced from PubChem (CID 18723563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).