C11H23N — CID 18723717
1,2,3,4,5,6-hexamethylpiperidine (PubChem CID 18723717) has the molecular formula C11H23N and a molecular weight of 169.31 g/mol. Its IUPAC name is 1,2,3,4,5,6-hexamethylpiperidine.
| Compound Name | 1,2,3,4,5,6-hexamethylpiperidine |
|---|---|
| PubChem CID | 18723717 |
| Molecular Formula | C11H23N |
| Molecular Weight | 169.31 g/mol |
| Exact Mass | 169.18 |
| IUPAC Name | 1,2,3,4,5,6-hexamethylpiperidine |
| SMILES | CC1C(C)C(C)N(C)C(C)C1C |
| InChI | InChI=1S/C11H23N/c1-7-8(2)10(4)12(6)11(5)9(7)3/h7-11H,1-6H3 |
| InChIKey | KXAJYAXSGSTKSB-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.31 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |