C8H18N2 — CID 18723718
1,2,3,4,5-pentamethylimidazolidine (PubChem CID 18723718) has the molecular formula C8H18N2 and a molecular weight of 142.25 g/mol. Its IUPAC name is 1,2,3,4,5-pentamethylimidazolidine.
| Compound Name | 1,2,3,4,5-pentamethylimidazolidine |
|---|---|
| PubChem CID | 18723718 |
| Molecular Formula | C8H18N2 |
| Molecular Weight | 142.25 g/mol |
| Exact Mass | 142.15 |
| IUPAC Name | 1,2,3,4,5-pentamethylimidazolidine |
| SMILES | CC1C(C)N(C)C(C)N1C |
| InChI | InChI=1S/C8H18N2/c1-6-7(2)10(5)8(3)9(6)4/h6-8H,1-5H3 |
| InChIKey | IGRXDKYGAIAHFI-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.25 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |