C6H15N3 — CID 18723723
1,3,4,5-tetramethyl-1,2,4-triazolidine (PubChem CID 18723723) has the molecular formula C6H15N3 and a molecular weight of 129.21 g/mol. Its IUPAC name is 1,3,4,5-tetramethyl-1,2,4-triazolidine.
| Compound Name | 1,3,4,5-tetramethyl-1,2,4-triazolidine |
|---|---|
| PubChem CID | 18723723 |
| Molecular Formula | C6H15N3 |
| Molecular Weight | 129.21 g/mol |
| Exact Mass | 129.13 |
| IUPAC Name | 1,3,4,5-tetramethyl-1,2,4-triazolidine |
| SMILES | CC1NN(C)C(C)N1C |
| InChI | InChI=1S/C6H15N3/c1-5-7-9(4)6(2)8(5)3/h5-7H,1-4H3 |
| InChIKey | UYYJDFSWUATCBI-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.21 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |