C20H35NO3 — CID 18723752
(E)-2-[2-(ethylamino)-2-oxoethyl]-9,9-dimethyl-3-[(E)-prop-1-enyl]undec-6-enoic acid (PubChem CID 18723752) has the molecular formula C20H35NO3 and a molecular weight of 337.50 g/mol. Its IUPAC name is (E)-2-[2-(ethylamino)-2-oxoethyl]-9,9-dimethyl-3-[(E)-prop-1-enyl]undec-6-enoic acid.
| Compound Name | (E)-2-[2-(ethylamino)-2-oxoethyl]-9,9-dimethyl-3-[(E)-prop-1-enyl]undec-6-enoic acid |
|---|---|
| PubChem CID | 18723752 |
| Molecular Formula | C20H35NO3 |
| Molecular Weight | 337.50 g/mol |
| Exact Mass | 337.26 |
| IUPAC Name | (E)-2-[2-(ethylamino)-2-oxoethyl]-9,9-dimethyl-3-[(E)-prop-1-enyl]undec-6-enoic acid |
| SMILES | C/C=C/C(CC/C=C/CC(C)(C)CC)C(CC(=O)NCC)C(=O)O |
| InChI | InChI=1S/C20H35NO3/c1-6-12-16(13-10-9-11-14-20(4,5)7-2)17(19(23)24)15-18(22)21-8-3/h6,9,11-12,16-17H,7-8,10,13-15H2,1-5H3,(H,21,22)(H,23,24)/b11-9+,12-6+ |
| InChIKey | ATEADIAKGAGPST-WIPAEPSYSA-N |
| XLogP | 4.57 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.50 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|