About 3-(ethylcarbamoyl)-7,7-dimethyl-5-methylidenenonanoic acid
3-(ethylcarbamoyl)-7,7-dimethyl-5-methylidenenonanoic acid (PubChem CID 18723765) has the molecular formula C15H27NO3
and a molecular weight of 269.38 g/mol. Its IUPAC name is 3-(ethylcarbamoyl)-7,7-dimethyl-5-methylidenenonanoic acid.
Molecular Properties
| Compound Name | 3-(ethylcarbamoyl)-7,7-dimethyl-5-methylidenenonanoic acid |
| PubChem CID | 18723765 |
| Molecular Formula | C15H27NO3 |
| Molecular Weight | 269.38 g/mol |
| Exact Mass | 269.20 |
| IUPAC Name | 3-(ethylcarbamoyl)-7,7-dimethyl-5-methylidenenonanoic acid |
| SMILES | C=C(CC(CC(=O)O)C(=O)NCC)CC(C)(C)CC |
| InChI | InChI=1S/C15H27NO3/c1-6-15(4,5)10-11(3)8-12(9-13(17)18)14(19)16-7-2/h12H,3,6-10H2,1-2,4-5H3,(H,16,19)(H,17,18) |
| InChIKey | SGGCKHSBRHUMER-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.38 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(ethylcarbamoyl)-7,7-dimethyl-5-methylidenenonanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(ethylcarbamoyl)-7,7-dimethyl-5-methylidenenonanoic acid?
The IUPAC name of 3-(ethylcarbamoyl)-7,7-dimethyl-5-methylidenenonanoic acid (CID 18723765) is 3-(ethylcarbamoyl)-7,7-dimethyl-5-methylidenenonanoic acid.
What is the SMILES notation for 3-(ethylcarbamoyl)-7,7-dimethyl-5-methylidenenonanoic acid?
The canonical SMILES for 3-(ethylcarbamoyl)-7,7-dimethyl-5-methylidenenonanoic acid is C=C(CC(CC(=O)O)C(=O)NCC)CC(C)(C)CC.
What is the InChIKey of 3-(ethylcarbamoyl)-7,7-dimethyl-5-methylidenenonanoic acid?
The InChIKey is SGGCKHSBRHUMER-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27NO3/c1-6-15(4,5)10-11(3)8-12(9-13(17)18)14(19)16-7-2/h12H,3,6-10H2,1-2,4-5H3,(H,16,19)(H,17,18).
What are the key properties of 3-(ethylcarbamoyl)-7,7-dimethyl-5-methylidenenonanoic acid?
3-(ethylcarbamoyl)-7,7-dimethyl-5-methylidenenonanoic acid has a molecular weight of 269.38 g/mol, XLogP of 2.99, 9 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(ethylcarbamoyl)-7,7-dimethyl-5-methylidenenonanoic acid is sourced from PubChem (CID 18723765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).