C26H45Br2NO3 — CID 18723774
(E)-6,7-dibromo-2-[2-(butylamino)-2-oxoethyl]-13,13-dimethyl-3-[(E)-prop-1-enyl]pentadec-10-enoic acid (PubChem CID 18723774) has the molecular formula C26H45Br2NO3 and a molecular weight of 579.46 g/mol. Its IUPAC name is (E)-6,7-dibromo-2-[2-(butylamino)-2-oxoethyl]-13,13-dimethyl-3-[(E)-prop-1-enyl]pentadec-10-enoic acid.
| Compound Name | (E)-6,7-dibromo-2-[2-(butylamino)-2-oxoethyl]-13,13-dimethyl-3-[(E)-prop-1-enyl]pentadec-10-enoic acid |
|---|---|
| PubChem CID | 18723774 |
| Molecular Formula | C26H45Br2NO3 |
| Molecular Weight | 579.46 g/mol |
| Exact Mass | 577.18 |
| IUPAC Name | (E)-6,7-dibromo-2-[2-(butylamino)-2-oxoethyl]-13,13-dimethyl-3-[(E)-prop-1-enyl]pentadec-10-enoic acid |
| SMILES | C/C=C/C(CCC(Br)C(Br)CC/C=C/CC(C)(C)CC)C(CC(=O)NCCCC)C(=O)O |
| InChI | InChI=1S/C26H45Br2NO3/c1-6-9-18-29-24(30)19-21(25(31)32)20(13-7-2)15-16-23(28)22(27)14-11-10-12-17-26(4,5)8-3/h7,10,12-13,20-23H,6,8-9,11,14-19H2,1-5H3,(H,29,30)(H,31,32)/b12-10+,13-7+ |
| InChIKey | JFBDAYBCOPPLCH-PVYBRLDNSA-N |
| XLogP | 7.66 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.46 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|