C52H50N4O3S — CID 18723994
[4-[3-(3-amino-6-methylidenexanthen-9-yl)-2,5,6-tris[4-(dimethylamino)phenyl]-4-methylphenyl]sulfanylphenyl]methanediol (PubChem CID 18723994) has the molecular formula C52H50N4O3S and a molecular weight of 811.06 g/mol. Its IUPAC name is [4-[3-(3-amino-6-methylidenexanthen-9-yl)-2,5,6-tris[4-(dimethylamino)phenyl]-4-methylphenyl]sulfanylphenyl]methanediol.
| Compound Name | [4-[3-(3-amino-6-methylidenexanthen-9-yl)-2,5,6-tris[4-(dimethylamino)phenyl]-4-methylphenyl]sulfanylphenyl]methanediol |
|---|---|
| PubChem CID | 18723994 |
| Molecular Formula | C52H50N4O3S |
| Molecular Weight | 811.06 g/mol |
| Exact Mass | 810.36 |
| IUPAC Name | [4-[3-(3-amino-6-methylidenexanthen-9-yl)-2,5,6-tris[4-(dimethylamino)phenyl]-4-methylphenyl]sulfanylphenyl]methanediol |
| SMILES | C=c1ccc2c(c1)Oc1cc(N)ccc1C=2c1c(C)c(-c2ccc(N(C)C)cc2)c(-c2ccc(N(C)C)cc2)c(Sc2ccc(C(O)O)cc2)c1-c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C52H50N4O3S/c1-31-9-27-42-44(29-31)59-45-30-37(53)18-28-43(45)50(42)47-32(2)46(33-10-19-38(20-11-33)54(3)4)48(34-12-21-39(22-13-34)55(5)6)51(60-41-25-16-36(17-26-41)52(57)58)49(47)35-14-23-40(24-15-35)56(7)8/h9-30,52,57-58H,1,53H2,2-8H3 |
| InChIKey | JYTHOTJXMDTIMT-UHFFFAOYSA-N |
| XLogP | 9.67 |
| TPSA | 85.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.06 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|