C23H19F4NO4 — CID 18724040
2,3,4,5-tetrafluoro-6-(8-hydroxy-2,2,4-trimethyl-1-azatricyclo[7.3.1.05,13]trideca-3,5,7,9(13)-tetraene-7-carbonyl)benzoic acid (PubChem CID 18724040) has the molecular formula C23H19F4NO4 and a molecular weight of 449.40 g/mol. Its IUPAC name is 2,3,4,5-tetrafluoro-6-(8-hydroxy-2,2,4-trimethyl-1-azatricyclo[7.3.1.05,13]trideca-3,5,7,9(13)-tetraene-7-carbonyl)benzoic acid.
| Compound Name | 2,3,4,5-tetrafluoro-6-(8-hydroxy-2,2,4-trimethyl-1-azatricyclo[7.3.1.05,13]trideca-3,5,7,9(13)-tetraene-7-carbonyl)benzoic acid |
|---|---|
| PubChem CID | 18724040 |
| Molecular Formula | C23H19F4NO4 |
| Molecular Weight | 449.40 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | 2,3,4,5-tetrafluoro-6-(8-hydroxy-2,2,4-trimethyl-1-azatricyclo[7.3.1.05,13]trideca-3,5,7,9(13)-tetraene-7-carbonyl)benzoic acid |
| SMILES | CC1=CC(C)(C)N2CCCc3c(O)c(C(=O)c4c(F)c(F)c(F)c(F)c4C(=O)O)cc1c32 |
| InChI | InChI=1S/C23H19F4NO4/c1-9-8-23(2,3)28-6-4-5-10-19(28)11(9)7-12(20(10)29)21(30)13-14(22(31)32)16(25)18(27)17(26)15(13)24/h7-8,29H,4-6H2,1-3H3,(H,31,32) |
| InChIKey | JIKCTJWRADEPFU-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.40 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|