C28H48O6 — CID 18724138
2-ethyl-2,4,6,6-tetramethyl-4-[(2-methylpropan-2-yl)oxycarbonyl]-7-oxo-7-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]heptanoic acid (PubChem CID 18724138) has the molecular formula C28H48O6 and a molecular weight of 480.69 g/mol. Its IUPAC name is 2-ethyl-2,4,6,6-tetramethyl-4-[(2-methylpropan-2-yl)oxycarbonyl]-7-oxo-7-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]heptanoic acid.
| Compound Name | 2-ethyl-2,4,6,6-tetramethyl-4-[(2-methylpropan-2-yl)oxycarbonyl]-7-oxo-7-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]heptanoic acid |
|---|---|
| PubChem CID | 18724138 |
| Molecular Formula | C28H48O6 |
| Molecular Weight | 480.69 g/mol |
| Exact Mass | 480.35 |
| IUPAC Name | 2-ethyl-2,4,6,6-tetramethyl-4-[(2-methylpropan-2-yl)oxycarbonyl]-7-oxo-7-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]heptanoic acid |
| SMILES | CCC(C)(CC(C)(CC(C)(C)C(=O)OC1CC2CCC1(C)C2(C)C)C(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C28H48O6/c1-12-26(9,20(29)30)17-27(10,22(32)34-23(2,3)4)16-24(5,6)21(31)33-19-15-18-13-14-28(19,11)25(18,7)8/h18-19H,12-17H2,1-11H3,(H,29,30) |
| InChIKey | HOFDYFVYHQFBQY-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.69 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |