About 6-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]-N-ethylhexanamide
6-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]-N-ethylhexanamide (PubChem CID 18724283) has the molecular formula C16H25N3O4
and a molecular weight of 323.39 g/mol. Its IUPAC name is 6-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]-N-ethylhexanamide.
Molecular Properties
| Compound Name | 6-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]-N-ethylhexanamide |
| PubChem CID | 18724283 |
| Molecular Formula | C16H25N3O4 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | 6-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]-N-ethylhexanamide |
| SMILES | CCNC(=O)CCCCCNC(=O)CCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C16H25N3O4/c1-2-17-13(20)7-4-3-5-11-18-14(21)8-6-12-19-15(22)9-10-16(19)23/h9-10H,2-8,11-12H2,1H3,(H,17,20)(H,18,21) |
| InChIKey | XPWRRYFKKPRWAB-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 6-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]-N-ethylhexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]-N-ethylhexanamide?
The IUPAC name of 6-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]-N-ethylhexanamide (CID 18724283) is 6-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]-N-ethylhexanamide.
What is the SMILES notation for 6-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]-N-ethylhexanamide?
The canonical SMILES for 6-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]-N-ethylhexanamide is CCNC(=O)CCCCCNC(=O)CCCN1C(=O)C=CC1=O.
What is the InChIKey of 6-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]-N-ethylhexanamide?
The InChIKey is XPWRRYFKKPRWAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25N3O4/c1-2-17-13(20)7-4-3-5-11-18-14(21)8-6-12-19-15(22)9-10-16(19)23/h9-10H,2-8,11-12H2,1H3,(H,17,20)(H,18,21).
What are the key properties of 6-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]-N-ethylhexanamide?
6-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]-N-ethylhexanamide has a molecular weight of 323.39 g/mol, XLogP of 0.50, 11 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[4-(2,5-dioxopyrrol-1-yl)butanoylamino]-N-ethylhexanamide is sourced from PubChem (CID 18724283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).