C32H32N2O6 — CID 18724419
4,19-ditert-butyl-8,11,23,26-tetraoxa-4,19-diazaheptacyclo[16.12.0.03,16.05,14.07,12.020,29.022,27]triaconta-1,3(16),5,7(12),13,17,20,22(27),28-nonaene-15,30-dione (PubChem CID 18724419) has the molecular formula C32H32N2O6 and a molecular weight of 540.62 g/mol. Its IUPAC name is 4,19-ditert-butyl-8,11,23,26-tetraoxa-4,19-diazaheptacyclo[16.12.0.03,16.05,14.07,12.020,29.022,27]triaconta-1,3(16),5,7(12),13,17,20,22(27),28-nonaene-15,30-dione.
| Compound Name | 4,19-ditert-butyl-8,11,23,26-tetraoxa-4,19-diazaheptacyclo[16.12.0.03,16.05,14.07,12.020,29.022,27]triaconta-1,3(16),5,7(12),13,17,20,22(27),28-nonaene-15,30-dione |
|---|---|
| PubChem CID | 18724419 |
| Molecular Formula | C32H32N2O6 |
| Molecular Weight | 540.62 g/mol |
| Exact Mass | 540.23 |
| IUPAC Name | 4,19-ditert-butyl-8,11,23,26-tetraoxa-4,19-diazaheptacyclo[16.12.0.03,16.05,14.07,12.020,29.022,27]triaconta-1,3(16),5,7(12),13,17,20,22(27),28-nonaene-15,30-dione |
| SMILES | CC(C)(C)n1c2cc3c(cc2c(=O)c2cc4c(cc21)c(=O)c1cc2c(cc1n4C(C)(C)C)OCCO2)OCCO3 |
| InChI | InChI=1S/C32H32N2O6/c1-31(2,3)33-21-11-18-22(12-17(21)29(35)19-13-25-27(15-23(19)33)39-9-7-37-25)34(32(4,5)6)24-16-28-26(38-8-10-40-28)14-20(24)30(18)36/h11-16H,7-10H2,1-6H3 |
| InChIKey | CTYZTTWPCLJZOS-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 80.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.62 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|