C36H42ClN3O5 — CID 18724751
N-(7-chloro-4-hydroxy-2-oxospiro[1H-indole-3,1'-cyclohexane]-5-yl)-3-[2-(4-methyl-2-pentylphenoxy)butanoylamino]benzamide (PubChem CID 18724751) has the molecular formula C36H42ClN3O5 and a molecular weight of 632.20 g/mol. Its IUPAC name is N-(7-chloro-4-hydroxy-2-oxospiro[1H-indole-3,1'-cyclohexane]-5-yl)-3-[2-(4-methyl-2-pentylphenoxy)butanoylamino]benzamide.
| Compound Name | N-(7-chloro-4-hydroxy-2-oxospiro[1H-indole-3,1'-cyclohexane]-5-yl)-3-[2-(4-methyl-2-pentylphenoxy)butanoylamino]benzamide |
|---|---|
| PubChem CID | 18724751 |
| Molecular Formula | C36H42ClN3O5 |
| Molecular Weight | 632.20 g/mol |
| Exact Mass | 631.28 |
| IUPAC Name | N-(7-chloro-4-hydroxy-2-oxospiro[1H-indole-3,1'-cyclohexane]-5-yl)-3-[2-(4-methyl-2-pentylphenoxy)butanoylamino]benzamide |
| SMILES | CCCCCc1cc(C)ccc1OC(CC)C(=O)Nc1cccc(C(=O)Nc2cc(Cl)c3c(c2O)C2(CCCCC2)C(=O)N3)c1 |
| InChI | InChI=1S/C36H42ClN3O5/c1-4-6-8-12-23-19-22(3)15-16-29(23)45-28(5-2)34(43)38-25-14-11-13-24(20-25)33(42)39-27-21-26(37)31-30(32(27)41)36(35(44)40-31)17-9-7-10-18-36/h11,13-16,19-21,28,41H,4-10,12,17-18H2,1-3H3,(H,38,43)(H,39,42)(H,40,44) |
| InChIKey | UUYDAJOSGDQRLT-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.20 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|