About N-(7-chloro-4-hydroxy-3,3-dimethyl-2-oxo-1H-indol-5-yl)-3-methylbenzamide
N-(7-chloro-4-hydroxy-3,3-dimethyl-2-oxo-1H-indol-5-yl)-3-methylbenzamide (PubChem CID 18724752) has the molecular formula C18H17ClN2O3
and a molecular weight of 344.80 g/mol. Its IUPAC name is N-(7-chloro-4-hydroxy-3,3-dimethyl-2-oxo-1H-indol-5-yl)-3-methylbenzamide.
Molecular Properties
| Compound Name | N-(7-chloro-4-hydroxy-3,3-dimethyl-2-oxo-1H-indol-5-yl)-3-methylbenzamide |
| PubChem CID | 18724752 |
| Molecular Formula | C18H17ClN2O3 |
| Molecular Weight | 344.80 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | N-(7-chloro-4-hydroxy-3,3-dimethyl-2-oxo-1H-indol-5-yl)-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)Nc2cc(Cl)c3c(c2O)C(C)(C)C(=O)N3)c1 |
| InChI | InChI=1S/C18H17ClN2O3/c1-9-5-4-6-10(7-9)16(23)20-12-8-11(19)14-13(15(12)22)18(2,3)17(24)21-14/h4-8,22H,1-3H3,(H,20,23)(H,21,24) |
| InChIKey | FBSDLKXQOVBHRB-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.80 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze N-(7-chloro-4-hydroxy-3,3-dimethyl-2-oxo-1H-indol-5-yl)-3-methylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(7-chloro-4-hydroxy-3,3-dimethyl-2-oxo-1H-indol-5-yl)-3-methylbenzamide?
The IUPAC name of N-(7-chloro-4-hydroxy-3,3-dimethyl-2-oxo-1H-indol-5-yl)-3-methylbenzamide (CID 18724752) is N-(7-chloro-4-hydroxy-3,3-dimethyl-2-oxo-1H-indol-5-yl)-3-methylbenzamide.
What is the SMILES notation for N-(7-chloro-4-hydroxy-3,3-dimethyl-2-oxo-1H-indol-5-yl)-3-methylbenzamide?
The canonical SMILES for N-(7-chloro-4-hydroxy-3,3-dimethyl-2-oxo-1H-indol-5-yl)-3-methylbenzamide is Cc1cccc(C(=O)Nc2cc(Cl)c3c(c2O)C(C)(C)C(=O)N3)c1.
What is the InChIKey of N-(7-chloro-4-hydroxy-3,3-dimethyl-2-oxo-1H-indol-5-yl)-3-methylbenzamide?
The InChIKey is FBSDLKXQOVBHRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17ClN2O3/c1-9-5-4-6-10(7-9)16(23)20-12-8-11(19)14-13(15(12)22)18(2,3)17(24)21-14/h4-8,22H,1-3H3,(H,20,23)(H,21,24).
What are the key properties of N-(7-chloro-4-hydroxy-3,3-dimethyl-2-oxo-1H-indol-5-yl)-3-methylbenzamide?
N-(7-chloro-4-hydroxy-3,3-dimethyl-2-oxo-1H-indol-5-yl)-3-methylbenzamide has a molecular weight of 344.80 g/mol, XLogP of 3.84, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(7-chloro-4-hydroxy-3,3-dimethyl-2-oxo-1H-indol-5-yl)-3-methylbenzamide is sourced from PubChem (CID 18724752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).