C19H19ClN2O3 — CID 18724754
N-(8-chloro-5-hydroxy-4,4-dimethyl-2-oxo-1,3-dihydroquinolin-6-yl)-2-methylbenzamide (PubChem CID 18724754) has the molecular formula C19H19ClN2O3 and a molecular weight of 358.83 g/mol. Its IUPAC name is N-(8-chloro-5-hydroxy-4,4-dimethyl-2-oxo-1,3-dihydroquinolin-6-yl)-2-methylbenzamide.
| Compound Name | N-(8-chloro-5-hydroxy-4,4-dimethyl-2-oxo-1,3-dihydroquinolin-6-yl)-2-methylbenzamide |
|---|---|
| PubChem CID | 18724754 |
| Molecular Formula | C19H19ClN2O3 |
| Molecular Weight | 358.83 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | N-(8-chloro-5-hydroxy-4,4-dimethyl-2-oxo-1,3-dihydroquinolin-6-yl)-2-methylbenzamide |
| SMILES | Cc1ccccc1C(=O)Nc1cc(Cl)c2c(c1O)C(C)(C)CC(=O)N2 |
| InChI | InChI=1S/C19H19ClN2O3/c1-10-6-4-5-7-11(10)18(25)21-13-8-12(20)16-15(17(13)24)19(2,3)9-14(23)22-16/h4-8,24H,9H2,1-3H3,(H,21,25)(H,22,23) |
| InChIKey | PGPLRKSKNFDLGY-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.83 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|