C21H13O6S2- — CID 18724761
1,1-dioxo-2-[(1E,3E,5E)-5-(1,1,3-trioxo-1-benzothiophen-2-ylidene)penta-1,3-dienyl]-1-benzothiophen-3-olate (PubChem CID 18724761) has the molecular formula C21H13O6S2- and a molecular weight of 425.46 g/mol. Its IUPAC name is 1,1-dioxo-2-[(1E,3E,5E)-5-(1,1,3-trioxo-1-benzothiophen-2-ylidene)penta-1,3-dienyl]-1-benzothiophen-3-olate.
| Compound Name | 1,1-dioxo-2-[(1E,3E,5E)-5-(1,1,3-trioxo-1-benzothiophen-2-ylidene)penta-1,3-dienyl]-1-benzothiophen-3-olate |
|---|---|
| PubChem CID | 18724761 |
| Molecular Formula | C21H13O6S2- |
| Molecular Weight | 425.46 g/mol |
| Exact Mass | 425.02 |
| IUPAC Name | 1,1-dioxo-2-[(1E,3E,5E)-5-(1,1,3-trioxo-1-benzothiophen-2-ylidene)penta-1,3-dienyl]-1-benzothiophen-3-olate |
| SMILES | O=C1/C(=C\C=C\C=C\C2=C([O-])c3ccccc3S2(=O)=O)S(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C21H14O6S2/c22-20-14-8-4-6-10-16(14)28(24,25)18(20)12-2-1-3-13-19-21(23)15-9-5-7-11-17(15)29(19,26)27/h1-13,22H/p-1/b3-1+,12-2+,19-13+ |
| InChIKey | DRNUFORIKYUGHQ-JPPIZABWSA-M |
| XLogP | 2.17 |
| TPSA | 108.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.46 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|