C26H22N6O5S2 — CID 18724844
N-[4-[(3E,5E,7E)-1,1,3-tricyano-7-[5-(methanesulfonamido)-3-methyl-1,3-benzoxazol-2-ylidene]hepta-1,3,5-trien-2-yl]phenyl]methanesulfonamide (PubChem CID 18724844) has the molecular formula C26H22N6O5S2 and a molecular weight of 562.63 g/mol. Its IUPAC name is N-[4-[(3E,5E,7E)-1,1,3-tricyano-7-[5-(methanesulfonamido)-3-methyl-1,3-benzoxazol-2-ylidene]hepta-1,3,5-trien-2-yl]phenyl]methanesulfonamide.
| Compound Name | N-[4-[(3E,5E,7E)-1,1,3-tricyano-7-[5-(methanesulfonamido)-3-methyl-1,3-benzoxazol-2-ylidene]hepta-1,3,5-trien-2-yl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 18724844 |
| Molecular Formula | C26H22N6O5S2 |
| Molecular Weight | 562.63 g/mol |
| Exact Mass | 562.11 |
| IUPAC Name | N-[4-[(3E,5E,7E)-1,1,3-tricyano-7-[5-(methanesulfonamido)-3-methyl-1,3-benzoxazol-2-ylidene]hepta-1,3,5-trien-2-yl]phenyl]methanesulfonamide |
| SMILES | CN1/C(=C\C=C\C=C(\C#N)C(=C(C#N)C#N)c2ccc(NS(C)(=O)=O)cc2)Oc2ccc(NS(C)(=O)=O)cc21 |
| InChI | InChI=1S/C26H22N6O5S2/c1-32-23-14-22(31-39(3,35)36)12-13-24(23)37-25(32)7-5-4-6-19(15-27)26(20(16-28)17-29)18-8-10-21(11-9-18)30-38(2,33)34/h4-14,30-31H,1-3H3/b5-4+,19-6-,25-7+ |
| InChIKey | JKHAVCVCSCVJKB-ZEVCEHPQSA-N |
| XLogP | 3.61 |
| TPSA | 176.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.63 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|