C20H33NaO8 — CID 18724951
sodium 4-carboxy-2-[3-[2-(2,2-dimethylbutanoyloxy)ethoxy]-2,2-dimethyl-3-oxopropyl]hexanoate (PubChem CID 18724951) has the molecular formula C20H33NaO8 and a molecular weight of 424.47 g/mol. Its IUPAC name is sodium 4-carboxy-2-[3-[2-(2,2-dimethylbutanoyloxy)ethoxy]-2,2-dimethyl-3-oxopropyl]hexanoate.
| Compound Name | sodium 4-carboxy-2-[3-[2-(2,2-dimethylbutanoyloxy)ethoxy]-2,2-dimethyl-3-oxopropyl]hexanoate |
|---|---|
| PubChem CID | 18724951 |
| Molecular Formula | C20H33NaO8 |
| Molecular Weight | 424.47 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | sodium 4-carboxy-2-[3-[2-(2,2-dimethylbutanoyloxy)ethoxy]-2,2-dimethyl-3-oxopropyl]hexanoate |
| SMILES | CCC(CC(CC(C)(C)C(=O)OCCOC(=O)C(C)(C)CC)C(=O)[O-])C(=O)O.[Na+] |
| InChI | InChI=1S/C20H34O8.Na/c1-7-13(15(21)22)11-14(16(23)24)12-20(5,6)18(26)28-10-9-27-17(25)19(3,4)8-2;/h13-14H,7-12H2,1-6H3,(H,21,22)(H,23,24);/q;+1/p-1 |
| InChIKey | CMIRLLYGNLTGNC-UHFFFAOYSA-M |
| XLogP | -1.20 |
| TPSA | 130.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.47 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|