C15H15N2+ — CID 18725022
1-(3-phenylpropyl)pyridin-1-ium-3-carbonitrile (PubChem CID 18725022) has the molecular formula C15H15N2+ and a molecular weight of 223.30 g/mol. Its IUPAC name is 1-(3-phenylpropyl)pyridin-1-ium-3-carbonitrile.
| Compound Name | 1-(3-phenylpropyl)pyridin-1-ium-3-carbonitrile |
|---|---|
| PubChem CID | 18725022 |
| Molecular Formula | C15H15N2+ |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 1-(3-phenylpropyl)pyridin-1-ium-3-carbonitrile |
| SMILES | N#Cc1ccc[n+](CCCc2ccccc2)c1 |
| InChI | InChI=1S/C15H15N2/c16-12-15-9-5-11-17(13-15)10-4-8-14-6-2-1-3-7-14/h1-3,5-7,9,11,13H,4,8,10H2/q+1 |
| InChIKey | KEOYUMKINVCADB-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 27.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|