About 3,6,7-trimethyl-5H-pyrazolo[5,1-c][1,2,4]triazole
3,6,7-trimethyl-5H-pyrazolo[5,1-c][1,2,4]triazole (PubChem CID 18725095) has the molecular formula C7H10N4
and a molecular weight of 150.18 g/mol. Its IUPAC name is 3,6,7-trimethyl-5H-pyrazolo[5,1-c][1,2,4]triazole.
Analyze 3,6,7-trimethyl-5H-pyrazolo[5,1-c][1,2,4]triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6,7-trimethyl-5H-pyrazolo[5,1-c][1,2,4]triazole?
The IUPAC name of 3,6,7-trimethyl-5H-pyrazolo[5,1-c][1,2,4]triazole (CID 18725095) is 3,6,7-trimethyl-5H-pyrazolo[5,1-c][1,2,4]triazole.
What is the SMILES notation for 3,6,7-trimethyl-5H-pyrazolo[5,1-c][1,2,4]triazole?
The canonical SMILES for 3,6,7-trimethyl-5H-pyrazolo[5,1-c][1,2,4]triazole is Cc1[nH]n2c(C)nnc2c1C.
What is the InChIKey of 3,6,7-trimethyl-5H-pyrazolo[5,1-c][1,2,4]triazole?
The InChIKey is OOGFWAYCENKIFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N4/c1-4-5(2)10-11-6(3)8-9-7(4)11/h10H,1-3H3.
What are the key properties of 3,6,7-trimethyl-5H-pyrazolo[5,1-c][1,2,4]triazole?
3,6,7-trimethyl-5H-pyrazolo[5,1-c][1,2,4]triazole has a molecular weight of 150.18 g/mol, XLogP of 0.98, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6,7-trimethyl-5H-pyrazolo[5,1-c][1,2,4]triazole is sourced from PubChem (CID 18725095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).