About 10,10-dimethyl-4-azatricyclo[5.2.1.01,5]decane
10,10-dimethyl-4-azatricyclo[5.2.1.01,5]decane (PubChem CID 18725301) has the molecular formula C11H19N
and a molecular weight of 165.28 g/mol. Its IUPAC name is 10,10-dimethyl-4-azatricyclo[5.2.1.01,5]decane.
Molecular Properties
| Compound Name | 10,10-dimethyl-4-azatricyclo[5.2.1.01,5]decane |
| PubChem CID | 18725301 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | 10,10-dimethyl-4-azatricyclo[5.2.1.01,5]decane |
| SMILES | CC1(C)C2CCC13CCNC3C2 |
| InChI | InChI=1S/C11H19N/c1-10(2)8-3-4-11(10)5-6-12-9(11)7-8/h8-9,12H,3-7H2,1-2H3 |
| InChIKey | URTCDLUSLYIOHE-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 10,10-dimethyl-4-azatricyclo[5.2.1.01,5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10,10-dimethyl-4-azatricyclo[5.2.1.01,5]decane?
The IUPAC name of 10,10-dimethyl-4-azatricyclo[5.2.1.01,5]decane (CID 18725301) is 10,10-dimethyl-4-azatricyclo[5.2.1.01,5]decane.
What is the SMILES notation for 10,10-dimethyl-4-azatricyclo[5.2.1.01,5]decane?
The canonical SMILES for 10,10-dimethyl-4-azatricyclo[5.2.1.01,5]decane is CC1(C)C2CCC13CCNC3C2.
What is the InChIKey of 10,10-dimethyl-4-azatricyclo[5.2.1.01,5]decane?
The InChIKey is URTCDLUSLYIOHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N/c1-10(2)8-3-4-11(10)5-6-12-9(11)7-8/h8-9,12H,3-7H2,1-2H3.
What are the key properties of 10,10-dimethyl-4-azatricyclo[5.2.1.01,5]decane?
10,10-dimethyl-4-azatricyclo[5.2.1.01,5]decane has a molecular weight of 165.28 g/mol, XLogP of 2.17, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 10,10-dimethyl-4-azatricyclo[5.2.1.01,5]decane is sourced from PubChem (CID 18725301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).