C15H27NO — CID 18725347
1,1,2,2,6,6,8a-heptamethyl-7,8-dihydro-5H-indolizin-3-one (PubChem CID 18725347) has the molecular formula C15H27NO and a molecular weight of 237.39 g/mol. Its IUPAC name is 1,1,2,2,6,6,8a-heptamethyl-7,8-dihydro-5H-indolizin-3-one.
| Compound Name | 1,1,2,2,6,6,8a-heptamethyl-7,8-dihydro-5H-indolizin-3-one |
|---|---|
| PubChem CID | 18725347 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | 1,1,2,2,6,6,8a-heptamethyl-7,8-dihydro-5H-indolizin-3-one |
| SMILES | CC1(C)CCC2(C)N(C1)C(=O)C(C)(C)C2(C)C |
| InChI | InChI=1S/C15H27NO/c1-12(2)8-9-15(7)14(5,6)13(3,4)11(17)16(15)10-12/h8-10H2,1-7H3 |
| InChIKey | GGVUOGMJQKZMOR-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |