About 1,3-dichloro-5-(3,3-dichloroprop-2-enoxy)-4-fluoro-2-methoxybenzene
1,3-dichloro-5-(3,3-dichloroprop-2-enoxy)-4-fluoro-2-methoxybenzene (PubChem CID 18725399) has the molecular formula C10H7Cl4FO2
and a molecular weight of 319.97 g/mol. Its IUPAC name is 1,3-dichloro-5-(3,3-dichloroprop-2-enoxy)-4-fluoro-2-methoxybenzene.
Molecular Properties
| Compound Name | 1,3-dichloro-5-(3,3-dichloroprop-2-enoxy)-4-fluoro-2-methoxybenzene |
| PubChem CID | 18725399 |
| Molecular Formula | C10H7Cl4FO2 |
| Molecular Weight | 319.97 g/mol |
| Exact Mass | 317.92 |
| IUPAC Name | 1,3-dichloro-5-(3,3-dichloroprop-2-enoxy)-4-fluoro-2-methoxybenzene |
| SMILES | COc1c(Cl)cc(OCC=C(Cl)Cl)c(F)c1Cl |
| InChI | InChI=1S/C10H7Cl4FO2/c1-16-10-5(11)4-6(9(15)8(10)14)17-3-2-7(12)13/h2,4H,3H2,1H3 |
| InChIKey | UHVILXNTKBIPNN-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.97 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dichloro-5-(3,3-dichloroprop-2-enoxy)-4-fluoro-2-methoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dichloro-5-(3,3-dichloroprop-2-enoxy)-4-fluoro-2-methoxybenzene?
The IUPAC name of 1,3-dichloro-5-(3,3-dichloroprop-2-enoxy)-4-fluoro-2-methoxybenzene (CID 18725399) is 1,3-dichloro-5-(3,3-dichloroprop-2-enoxy)-4-fluoro-2-methoxybenzene.
What is the SMILES notation for 1,3-dichloro-5-(3,3-dichloroprop-2-enoxy)-4-fluoro-2-methoxybenzene?
The canonical SMILES for 1,3-dichloro-5-(3,3-dichloroprop-2-enoxy)-4-fluoro-2-methoxybenzene is COc1c(Cl)cc(OCC=C(Cl)Cl)c(F)c1Cl.
What is the InChIKey of 1,3-dichloro-5-(3,3-dichloroprop-2-enoxy)-4-fluoro-2-methoxybenzene?
The InChIKey is UHVILXNTKBIPNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7Cl4FO2/c1-16-10-5(11)4-6(9(15)8(10)14)17-3-2-7(12)13/h2,4H,3H2,1H3.
What are the key properties of 1,3-dichloro-5-(3,3-dichloroprop-2-enoxy)-4-fluoro-2-methoxybenzene?
1,3-dichloro-5-(3,3-dichloroprop-2-enoxy)-4-fluoro-2-methoxybenzene has a molecular weight of 319.97 g/mol, XLogP of 4.84, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dichloro-5-(3,3-dichloroprop-2-enoxy)-4-fluoro-2-methoxybenzene is sourced from PubChem (CID 18725399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).