About 1-chloro-5-(3,3-dibromoprop-2-enylsulfanyl)-3-fluoro-2-methoxybenzene
1-chloro-5-(3,3-dibromoprop-2-enylsulfanyl)-3-fluoro-2-methoxybenzene (PubChem CID 18725429) has the molecular formula C10H8Br2ClFOS
and a molecular weight of 390.50 g/mol. Its IUPAC name is 1-chloro-5-(3,3-dibromoprop-2-enylsulfanyl)-3-fluoro-2-methoxybenzene.
Molecular Properties
| Compound Name | 1-chloro-5-(3,3-dibromoprop-2-enylsulfanyl)-3-fluoro-2-methoxybenzene |
| PubChem CID | 18725429 |
| Molecular Formula | C10H8Br2ClFOS |
| Molecular Weight | 390.50 g/mol |
| Exact Mass | 387.83 |
| IUPAC Name | 1-chloro-5-(3,3-dibromoprop-2-enylsulfanyl)-3-fluoro-2-methoxybenzene |
| SMILES | COc1c(F)cc(SCC=C(Br)Br)cc1Cl |
| InChI | InChI=1S/C10H8Br2ClFOS/c1-15-10-7(13)4-6(5-8(10)14)16-3-2-9(11)12/h2,4-5H,3H2,1H3 |
| InChIKey | GYEYFIROFXGKMO-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 390.50 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-chloro-5-(3,3-dibromoprop-2-enylsulfanyl)-3-fluoro-2-methoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-5-(3,3-dibromoprop-2-enylsulfanyl)-3-fluoro-2-methoxybenzene?
The IUPAC name of 1-chloro-5-(3,3-dibromoprop-2-enylsulfanyl)-3-fluoro-2-methoxybenzene (CID 18725429) is 1-chloro-5-(3,3-dibromoprop-2-enylsulfanyl)-3-fluoro-2-methoxybenzene.
What is the SMILES notation for 1-chloro-5-(3,3-dibromoprop-2-enylsulfanyl)-3-fluoro-2-methoxybenzene?
The canonical SMILES for 1-chloro-5-(3,3-dibromoprop-2-enylsulfanyl)-3-fluoro-2-methoxybenzene is COc1c(F)cc(SCC=C(Br)Br)cc1Cl.
What is the InChIKey of 1-chloro-5-(3,3-dibromoprop-2-enylsulfanyl)-3-fluoro-2-methoxybenzene?
The InChIKey is GYEYFIROFXGKMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8Br2ClFOS/c1-15-10-7(13)4-6(5-8(10)14)16-3-2-9(11)12/h2,4-5H,3H2,1H3.
What are the key properties of 1-chloro-5-(3,3-dibromoprop-2-enylsulfanyl)-3-fluoro-2-methoxybenzene?
1-chloro-5-(3,3-dibromoprop-2-enylsulfanyl)-3-fluoro-2-methoxybenzene has a molecular weight of 390.50 g/mol, XLogP of 5.21, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-5-(3,3-dibromoprop-2-enylsulfanyl)-3-fluoro-2-methoxybenzene is sourced from PubChem (CID 18725429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).