C18H21ClO5S — CID 18725542
2-[(2-chloro-3-ethyl-4-methylsulfonylphenyl)-hydroxymethylidene]-5,5-dimethylcyclohexane-1,3-dione (PubChem CID 18725542) has the molecular formula C18H21ClO5S and a molecular weight of 384.88 g/mol. Its IUPAC name is 2-[(2-chloro-3-ethyl-4-methylsulfonylphenyl)-hydroxymethylidene]-5,5-dimethylcyclohexane-1,3-dione.
| Compound Name | 2-[(2-chloro-3-ethyl-4-methylsulfonylphenyl)-hydroxymethylidene]-5,5-dimethylcyclohexane-1,3-dione |
|---|---|
| PubChem CID | 18725542 |
| Molecular Formula | C18H21ClO5S |
| Molecular Weight | 384.88 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | 2-[(2-chloro-3-ethyl-4-methylsulfonylphenyl)-hydroxymethylidene]-5,5-dimethylcyclohexane-1,3-dione |
| SMILES | CCc1c(S(C)(=O)=O)ccc(C(O)=C2C(=O)CC(C)(C)CC2=O)c1Cl |
| InChI | InChI=1S/C18H21ClO5S/c1-5-10-14(25(4,23)24)7-6-11(16(10)19)17(22)15-12(20)8-18(2,3)9-13(15)21/h6-7,22H,5,8-9H2,1-4H3 |
| InChIKey | JNXNUSGYAZQZIB-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.88 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|