C10H15F6NO3 — CID 18725572
4-[1,1,2,2,3,3-hexafluoro-3-(2-methoxyethoxy)propyl]morpholine (PubChem CID 18725572) has the molecular formula C10H15F6NO3 and a molecular weight of 311.22 g/mol. Its IUPAC name is 4-[1,1,2,2,3,3-hexafluoro-3-(2-methoxyethoxy)propyl]morpholine.
| Compound Name | 4-[1,1,2,2,3,3-hexafluoro-3-(2-methoxyethoxy)propyl]morpholine |
|---|---|
| PubChem CID | 18725572 |
| Molecular Formula | C10H15F6NO3 |
| Molecular Weight | 311.22 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 4-[1,1,2,2,3,3-hexafluoro-3-(2-methoxyethoxy)propyl]morpholine |
| SMILES | COCCOC(F)(F)C(F)(F)C(F)(F)N1CCOCC1 |
| InChI | InChI=1S/C10H15F6NO3/c1-18-6-7-20-10(15,16)8(11,12)9(13,14)17-2-4-19-5-3-17/h2-7H2,1H3 |
| InChIKey | YBXGBIUGNUOEFF-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.22 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|