C10H15F6NO2 — CID 18725573
4-(1,1,2,2,3,3-hexafluoro-3-methoxypropyl)-2,6-dimethylmorpholine (PubChem CID 18725573) has the molecular formula C10H15F6NO2 and a molecular weight of 295.22 g/mol. Its IUPAC name is 4-(1,1,2,2,3,3-hexafluoro-3-methoxypropyl)-2,6-dimethylmorpholine.
| Compound Name | 4-(1,1,2,2,3,3-hexafluoro-3-methoxypropyl)-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 18725573 |
| Molecular Formula | C10H15F6NO2 |
| Molecular Weight | 295.22 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 4-(1,1,2,2,3,3-hexafluoro-3-methoxypropyl)-2,6-dimethylmorpholine |
| SMILES | COC(F)(F)C(F)(F)C(F)(F)N1CC(C)OC(C)C1 |
| InChI | InChI=1S/C10H15F6NO2/c1-6-4-17(5-7(2)19-6)9(13,14)8(11,12)10(15,16)18-3/h6-7H,4-5H2,1-3H3 |
| InChIKey | QLXGMAPTMAYBMI-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.22 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|