C9H11F8NO2 — CID 18725576
4-(1,1,1,2,3,3,4,4-octafluoro-4-methoxybutan-2-yl)morpholine (PubChem CID 18725576) has the molecular formula C9H11F8NO2 and a molecular weight of 317.18 g/mol. Its IUPAC name is 4-(1,1,1,2,3,3,4,4-octafluoro-4-methoxybutan-2-yl)morpholine.
| Compound Name | 4-(1,1,1,2,3,3,4,4-octafluoro-4-methoxybutan-2-yl)morpholine |
|---|---|
| PubChem CID | 18725576 |
| Molecular Formula | C9H11F8NO2 |
| Molecular Weight | 317.18 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | 4-(1,1,1,2,3,3,4,4-octafluoro-4-methoxybutan-2-yl)morpholine |
| SMILES | COC(F)(F)C(F)(F)C(F)(N1CCOCC1)C(F)(F)F |
| InChI | InChI=1S/C9H11F8NO2/c1-19-9(16,17)6(10,11)7(12,8(13,14)15)18-2-4-20-5-3-18/h2-5H2,1H3 |
| InChIKey | SBRQKNYAZCQBQL-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.18 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|