C8H7F12NO2 — CID 18725581
N-[1,1-difluoro-2-(fluoromethoxy)ethyl]-1,1,2,2,3,3-hexafluoro-3-methoxy-N-(trifluoromethyl)propan-1-amine (PubChem CID 18725581) has the molecular formula C8H7F12NO2 and a molecular weight of 377.13 g/mol. Its IUPAC name is N-[1,1-difluoro-2-(fluoromethoxy)ethyl]-1,1,2,2,3,3-hexafluoro-3-methoxy-N-(trifluoromethyl)propan-1-amine.
| Compound Name | N-[1,1-difluoro-2-(fluoromethoxy)ethyl]-1,1,2,2,3,3-hexafluoro-3-methoxy-N-(trifluoromethyl)propan-1-amine |
|---|---|
| PubChem CID | 18725581 |
| Molecular Formula | C8H7F12NO2 |
| Molecular Weight | 377.13 g/mol |
| Exact Mass | 377.03 |
| IUPAC Name | N-[1,1-difluoro-2-(fluoromethoxy)ethyl]-1,1,2,2,3,3-hexafluoro-3-methoxy-N-(trifluoromethyl)propan-1-amine |
| SMILES | COC(F)(F)C(F)(F)C(F)(F)N(C(F)(F)F)C(F)(F)COCF |
| InChI | InChI=1S/C8H7F12NO2/c1-22-7(16,17)5(12,13)6(14,15)21(8(18,19)20)4(10,11)2-23-3-9/h2-3H2,1H3 |
| InChIKey | UGEUPKSWNQBRGD-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.13 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|