About (2-methyl-4,5-dihydroimidazol-1-yl)methanol
(2-methyl-4,5-dihydroimidazol-1-yl)methanol (PubChem CID 18725586) has the molecular formula C5H10N2O
and a molecular weight of 114.15 g/mol. Its IUPAC name is (2-methyl-4,5-dihydroimidazol-1-yl)methanol.
Molecular Properties
| Compound Name | (2-methyl-4,5-dihydroimidazol-1-yl)methanol |
| PubChem CID | 18725586 |
| Molecular Formula | C5H10N2O |
| Molecular Weight | 114.15 g/mol |
| Exact Mass | 114.08 |
| IUPAC Name | (2-methyl-4,5-dihydroimidazol-1-yl)methanol |
| SMILES | CC1=NCCN1CO |
| InChI | InChI=1S/C5H10N2O/c1-5-6-2-3-7(5)4-8/h8H,2-4H2,1H3 |
| InChIKey | WZHAKGBROOPXGQ-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.15 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-methyl-4,5-dihydroimidazol-1-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyl-4,5-dihydroimidazol-1-yl)methanol?
The IUPAC name of (2-methyl-4,5-dihydroimidazol-1-yl)methanol (CID 18725586) is (2-methyl-4,5-dihydroimidazol-1-yl)methanol.
What is the SMILES notation for (2-methyl-4,5-dihydroimidazol-1-yl)methanol?
The canonical SMILES for (2-methyl-4,5-dihydroimidazol-1-yl)methanol is CC1=NCCN1CO.
What is the InChIKey of (2-methyl-4,5-dihydroimidazol-1-yl)methanol?
The InChIKey is WZHAKGBROOPXGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2O/c1-5-6-2-3-7(5)4-8/h8H,2-4H2,1H3.
What are the key properties of (2-methyl-4,5-dihydroimidazol-1-yl)methanol?
(2-methyl-4,5-dihydroimidazol-1-yl)methanol has a molecular weight of 114.15 g/mol, XLogP of -0.33, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyl-4,5-dihydroimidazol-1-yl)methanol is sourced from PubChem (CID 18725586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).