C23H25N7O4S — CID 18725648
(2R,3R,4S,5R)-2-(hydroxymethyl)-5-[6-[[(3S)-1-(5-thiophen-2-yl-2-pyridinyl)pyrrolidin-3-yl]amino]purin-9-yl]oxolane-3,4-diol (PubChem CID 18725648) has the molecular formula C23H25N7O4S and a molecular weight of 495.57 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(hydroxymethyl)-5-[6-[[(3S)-1-(5-thiophen-2-yl-2-pyridinyl)pyrrolidin-3-yl]amino]purin-9-yl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-(hydroxymethyl)-5-[6-[[(3S)-1-(5-thiophen-2-yl-2-pyridinyl)pyrrolidin-3-yl]amino]purin-9-yl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 18725648 |
| Molecular Formula | C23H25N7O4S |
| Molecular Weight | 495.57 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | (2R,3R,4S,5R)-2-(hydroxymethyl)-5-[6-[[(3S)-1-(5-thiophen-2-yl-2-pyridinyl)pyrrolidin-3-yl]amino]purin-9-yl]oxolane-3,4-diol |
| SMILES | OC[C@H]1O[C@@H](n2cnc3c(N[C@H]4CCN(c5ccc(-c6cccs6)cn5)C4)ncnc32)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C23H25N7O4S/c31-10-15-19(32)20(33)23(34-15)30-12-27-18-21(25-11-26-22(18)30)28-14-5-6-29(9-14)17-4-3-13(8-24-17)16-2-1-7-35-16/h1-4,7-8,11-12,14-15,19-20,23,31-33H,5-6,9-10H2,(H,25,26,28)/t14-,15+,19-,20-,23+/m0/s1 |
| InChIKey | QIIULVFJOLPSEE-RVEDKHALSA-N |
| XLogP | 1.25 |
| TPSA | 141.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.57 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |