C20H18N4 — CID 18725796
2,3,7,8,23,24-hexahydroporphyrin (PubChem CID 18725796) has the molecular formula C20H18N4 and a molecular weight of 314.39 g/mol. Its IUPAC name is 2,3,7,8,23,24-hexahydroporphyrin.
| Compound Name | 2,3,7,8,23,24-hexahydroporphyrin |
|---|---|
| PubChem CID | 18725796 |
| Molecular Formula | C20H18N4 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 2,3,7,8,23,24-hexahydroporphyrin |
| SMILES | c1c2nc(cc3ccc(cc4ccc(cc5nc1CC5)[nH]4)[nH]3)CC2 |
| InChI | InChI=1S/C20H18N4/c1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14/h1-4,9-12,21-22H,5-8H2/b13-9-,14-10-,15-9-,16-10-,17-11-,18-12-,19-11-,20-12- |
| InChIKey | BMMKBVLOIDKBCY-CEVVSZFKSA-N |
| XLogP | 3.89 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |