C32H34N8O6 — CID 18725810
5-(5-benzyltetrazol-1-yl)-4-oxo-3-[2-[(3S)-2-oxo-3-(quinoline-3-carbonylamino)azepan-1-yl]propanoylamino]pentanoic acid (PubChem CID 18725810) has the molecular formula C32H34N8O6 and a molecular weight of 626.67 g/mol. Its IUPAC name is 5-(5-benzyltetrazol-1-yl)-4-oxo-3-[2-[(3S)-2-oxo-3-(quinoline-3-carbonylamino)azepan-1-yl]propanoylamino]pentanoic acid.
| Compound Name | 5-(5-benzyltetrazol-1-yl)-4-oxo-3-[2-[(3S)-2-oxo-3-(quinoline-3-carbonylamino)azepan-1-yl]propanoylamino]pentanoic acid |
|---|---|
| PubChem CID | 18725810 |
| Molecular Formula | C32H34N8O6 |
| Molecular Weight | 626.67 g/mol |
| Exact Mass | 626.26 |
| IUPAC Name | 5-(5-benzyltetrazol-1-yl)-4-oxo-3-[2-[(3S)-2-oxo-3-(quinoline-3-carbonylamino)azepan-1-yl]propanoylamino]pentanoic acid |
| SMILES | CC(C(=O)NC(CC(=O)O)C(=O)Cn1nnnc1Cc1ccccc1)N1CCCC[C@H](NC(=O)c2cnc3ccccc3c2)C1=O |
| InChI | InChI=1S/C32H34N8O6/c1-20(39-14-8-7-13-25(32(39)46)34-31(45)23-16-22-11-5-6-12-24(22)33-18-23)30(44)35-26(17-29(42)43)27(41)19-40-28(36-37-38-40)15-21-9-3-2-4-10-21/h2-6,9-12,16,18,20,25-26H,7-8,13-15,17,19H2,1H3,(H,34,45)(H,35,44)(H,42,43)/t20?,25-,26?/m0/s1 |
| InChIKey | XROYRCGQHRBGKZ-FQKSQLJCSA-N |
| XLogP | 1.54 |
| TPSA | 189.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.67 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |