About S-(2-methoxyethyl) N-[1-[5-(2,6-dichlorophenyl)sulfanyltetrazol-2-yl]-2-oxopentan-3-yl]carbamothioate
S-(2-methoxyethyl) N-[1-[5-(2,6-dichlorophenyl)sulfanyltetrazol-2-yl]-2-oxopentan-3-yl]carbamothioate (PubChem CID 18726466) has the molecular formula C16H19Cl2N5O3S2
and a molecular weight of 464.40 g/mol. Its IUPAC name is S-(2-methoxyethyl) N-[1-[5-(2,6-dichlorophenyl)sulfanyltetrazol-2-yl]-2-oxopentan-3-yl]carbamothioate.
Molecular Properties
| Compound Name | S-(2-methoxyethyl) N-[1-[5-(2,6-dichlorophenyl)sulfanyltetrazol-2-yl]-2-oxopentan-3-yl]carbamothioate |
| PubChem CID | 18726466 |
| Molecular Formula | C16H19Cl2N5O3S2 |
| Molecular Weight | 464.40 g/mol |
| Exact Mass | 463.03 |
| IUPAC Name | S-(2-methoxyethyl) N-[1-[5-(2,6-dichlorophenyl)sulfanyltetrazol-2-yl]-2-oxopentan-3-yl]carbamothioate |
| SMILES | CCC(NC(=O)SCCOC)C(=O)Cn1nnc(Sc2c(Cl)cccc2Cl)n1 |
| InChI | InChI=1S/C16H19Cl2N5O3S2/c1-3-12(19-16(25)27-8-7-26-2)13(24)9-23-21-15(20-22-23)28-14-10(17)5-4-6-11(14)18/h4-6,12H,3,7-9H2,1-2H3,(H,19,25) |
| InChIKey | PLAOTRIKUTZIFO-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 464.40 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(2-methoxyethyl) N-[1-[5-(2,6-dichlorophenyl)sulfanyltetrazol-2-yl]-2-oxopentan-3-yl]carbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(2-methoxyethyl) N-[1-[5-(2,6-dichlorophenyl)sulfanyltetrazol-2-yl]-2-oxopentan-3-yl]carbamothioate?
The IUPAC name of S-(2-methoxyethyl) N-[1-[5-(2,6-dichlorophenyl)sulfanyltetrazol-2-yl]-2-oxopentan-3-yl]carbamothioate (CID 18726466) is S-(2-methoxyethyl) N-[1-[5-(2,6-dichlorophenyl)sulfanyltetrazol-2-yl]-2-oxopentan-3-yl]carbamothioate.
What is the SMILES notation for S-(2-methoxyethyl) N-[1-[5-(2,6-dichlorophenyl)sulfanyltetrazol-2-yl]-2-oxopentan-3-yl]carbamothioate?
The canonical SMILES for S-(2-methoxyethyl) N-[1-[5-(2,6-dichlorophenyl)sulfanyltetrazol-2-yl]-2-oxopentan-3-yl]carbamothioate is CCC(NC(=O)SCCOC)C(=O)Cn1nnc(Sc2c(Cl)cccc2Cl)n1.
What is the InChIKey of S-(2-methoxyethyl) N-[1-[5-(2,6-dichlorophenyl)sulfanyltetrazol-2-yl]-2-oxopentan-3-yl]carbamothioate?
The InChIKey is PLAOTRIKUTZIFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19Cl2N5O3S2/c1-3-12(19-16(25)27-8-7-26-2)13(24)9-23-21-15(20-22-23)28-14-10(17)5-4-6-11(14)18/h4-6,12H,3,7-9H2,1-2H3,(H,19,25).
What are the key properties of S-(2-methoxyethyl) N-[1-[5-(2,6-dichlorophenyl)sulfanyltetrazol-2-yl]-2-oxopentan-3-yl]carbamothioate?
S-(2-methoxyethyl) N-[1-[5-(2,6-dichlorophenyl)sulfanyltetrazol-2-yl]-2-oxopentan-3-yl]carbamothioate has a molecular weight of 464.40 g/mol, XLogP of 3.57, 10 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for S-(2-methoxyethyl) N-[1-[5-(2,6-dichlorophenyl)sulfanyltetrazol-2-yl]-2-oxopentan-3-yl]carbamothioate is sourced from PubChem (CID 18726466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).