About 3,4-dimethyl-5-(1H-1,2,4-triazol-5-yl)-1,2,4-triazole
3,4-dimethyl-5-(1H-1,2,4-triazol-5-yl)-1,2,4-triazole (PubChem CID 18726643) has the molecular formula C6H8N6
and a molecular weight of 164.17 g/mol. Its IUPAC name is 3,4-dimethyl-5-(1H-1,2,4-triazol-5-yl)-1,2,4-triazole.
Analyze 3,4-dimethyl-5-(1H-1,2,4-triazol-5-yl)-1,2,4-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethyl-5-(1H-1,2,4-triazol-5-yl)-1,2,4-triazole?
The IUPAC name of 3,4-dimethyl-5-(1H-1,2,4-triazol-5-yl)-1,2,4-triazole (CID 18726643) is 3,4-dimethyl-5-(1H-1,2,4-triazol-5-yl)-1,2,4-triazole.
What is the SMILES notation for 3,4-dimethyl-5-(1H-1,2,4-triazol-5-yl)-1,2,4-triazole?
The canonical SMILES for 3,4-dimethyl-5-(1H-1,2,4-triazol-5-yl)-1,2,4-triazole is Cc1nnc(-c2ncn[nH]2)n1C.
What is the InChIKey of 3,4-dimethyl-5-(1H-1,2,4-triazol-5-yl)-1,2,4-triazole?
The InChIKey is DKBGRJWJQYVAPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N6/c1-4-9-11-6(12(4)2)5-7-3-8-10-5/h3H,1-2H3,(H,7,8,10).
What are the key properties of 3,4-dimethyl-5-(1H-1,2,4-triazol-5-yl)-1,2,4-triazole?
3,4-dimethyl-5-(1H-1,2,4-triazol-5-yl)-1,2,4-triazole has a molecular weight of 164.17 g/mol, XLogP of -0.09, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethyl-5-(1H-1,2,4-triazol-5-yl)-1,2,4-triazole is sourced from PubChem (CID 18726643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).